C16H21F3N2O3S — CID 53358426
2-tert-butyl-5-ethylsulfonyl-1-[2-(trifluoromethoxy)ethyl]benzimidazole (PubChem CID 53358426) has the molecular formula C16H21F3N2O3S and a molecular weight of 378.42 g/mol. Its IUPAC name is 2-tert-butyl-5-ethylsulfonyl-1-[2-(trifluoromethoxy)ethyl]benzimidazole.
| Compound Name | 2-tert-butyl-5-ethylsulfonyl-1-[2-(trifluoromethoxy)ethyl]benzimidazole |
|---|---|
| PubChem CID | 53358426 |
| Molecular Formula | C16H21F3N2O3S |
| Molecular Weight | 378.42 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | 2-tert-butyl-5-ethylsulfonyl-1-[2-(trifluoromethoxy)ethyl]benzimidazole |
| SMILES | CCS(=O)(=O)c1ccc2c(c1)nc(C(C)(C)C)n2CCOC(F)(F)F |
| InChI | InChI=1S/C16H21F3N2O3S/c1-5-25(22,23)11-6-7-13-12(10-11)20-14(15(2,3)4)21(13)8-9-24-16(17,18)19/h6-7,10H,5,8-9H2,1-4H3 |
| InChIKey | VCHRFDMGRWTDAX-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.42 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |