About (9H-fluoren-1-ylamino) acetate
(9H-fluoren-1-ylamino) acetate (PubChem CID 18186105) has the molecular formula C15H13NO2
and a molecular weight of 239.27 g/mol. Its IUPAC name is (9H-fluoren-1-ylamino) acetate.
Molecular Properties
| Compound Name | (9H-fluoren-1-ylamino) acetate |
| PubChem CID | 18186105 |
| Molecular Formula | C15H13NO2 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | (9H-fluoren-1-ylamino) acetate |
| SMILES | CC(=O)ONc1cccc2c1Cc1ccccc1-2 |
| InChI | InChI=1S/C15H13NO2/c1-10(17)18-16-15-8-4-7-13-12-6-3-2-5-11(12)9-14(13)15/h2-8,16H,9H2,1H3 |
| InChIKey | HUJCKSIXJJPMJU-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (9H-fluoren-1-ylamino) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (9H-fluoren-1-ylamino) acetate?
The IUPAC name of (9H-fluoren-1-ylamino) acetate (CID 18186105) is (9H-fluoren-1-ylamino) acetate.
What is the SMILES notation for (9H-fluoren-1-ylamino) acetate?
The canonical SMILES for (9H-fluoren-1-ylamino) acetate is CC(=O)ONc1cccc2c1Cc1ccccc1-2.
What is the InChIKey of (9H-fluoren-1-ylamino) acetate?
The InChIKey is HUJCKSIXJJPMJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13NO2/c1-10(17)18-16-15-8-4-7-13-12-6-3-2-5-11(12)9-14(13)15/h2-8,16H,9H2,1H3.
What are the key properties of (9H-fluoren-1-ylamino) acetate?
(9H-fluoren-1-ylamino) acetate has a molecular weight of 239.27 g/mol, XLogP of 3.15, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (9H-fluoren-1-ylamino) acetate is sourced from PubChem (CID 18186105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).