C13H9N3O6S2 — CID 18191272
2-(furan-2-yl)-5-(4-methylsulfonyl-2-nitrophenyl)sulfanyl-1,3,4-oxadiazole (PubChem CID 18191272) has the molecular formula C13H9N3O6S2 and a molecular weight of 367.36 g/mol. Its IUPAC name is 2-(furan-2-yl)-5-(4-methylsulfonyl-2-nitrophenyl)sulfanyl-1,3,4-oxadiazole.
| Compound Name | 2-(furan-2-yl)-5-(4-methylsulfonyl-2-nitrophenyl)sulfanyl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 18191272 |
| Molecular Formula | C13H9N3O6S2 |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 366.99 |
| IUPAC Name | 2-(furan-2-yl)-5-(4-methylsulfonyl-2-nitrophenyl)sulfanyl-1,3,4-oxadiazole |
| SMILES | CS(=O)(=O)c1ccc(Sc2nnc(-c3ccco3)o2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H9N3O6S2/c1-24(19,20)8-4-5-11(9(7-8)16(17)18)23-13-15-14-12(22-13)10-3-2-6-21-10/h2-7H,1H3 |
| InChIKey | OGLBTRZFVGMKTO-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 129.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|