C23H27NO3S — CID 18207857
(E)-3-(3-methoxy-4-prop-2-enoxyphenyl)-N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]prop-2-enamide (PubChem CID 18207857) has the molecular formula C23H27NO3S and a molecular weight of 397.54 g/mol. Its IUPAC name is (E)-3-(3-methoxy-4-prop-2-enoxyphenyl)-N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]prop-2-enamide.
| Compound Name | (E)-3-(3-methoxy-4-prop-2-enoxyphenyl)-N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 18207857 |
| Molecular Formula | C23H27NO3S |
| Molecular Weight | 397.54 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | (E)-3-(3-methoxy-4-prop-2-enoxyphenyl)-N-[2-[(4-methylphenyl)methylsulfanyl]ethyl]prop-2-enamide |
| SMILES | C=CCOc1ccc(/C=C/C(=O)NCCSCc2ccc(C)cc2)cc1OC |
| InChI | InChI=1S/C23H27NO3S/c1-4-14-27-21-11-9-19(16-22(21)26-3)10-12-23(25)24-13-15-28-17-20-7-5-18(2)6-8-20/h4-12,16H,1,13-15,17H2,2-3H3,(H,24,25)/b12-10+ |
| InChIKey | YEXQVWYKDAVKNX-ZRDIBKRKSA-N |
| XLogP | 4.63 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.54 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|