C26H29N3O — CID 18208846
N-[(1,3-diphenylpyrazol-4-yl)methyl]-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxamide (PubChem CID 18208846) has the molecular formula C26H29N3O and a molecular weight of 399.54 g/mol. Its IUPAC name is N-[(1,3-diphenylpyrazol-4-yl)methyl]-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxamide.
| Compound Name | N-[(1,3-diphenylpyrazol-4-yl)methyl]-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 18208846 |
| Molecular Formula | C26H29N3O |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.23 |
| IUPAC Name | N-[(1,3-diphenylpyrazol-4-yl)methyl]-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxamide |
| SMILES | CC(C)=CC1C(C(=O)NCc2cn(-c3ccccc3)nc2-c2ccccc2)C1(C)C |
| InChI | InChI=1S/C26H29N3O/c1-18(2)15-22-23(26(22,3)4)25(30)27-16-20-17-29(21-13-9-6-10-14-21)28-24(20)19-11-7-5-8-12-19/h5-15,17,22-23H,16H2,1-4H3,(H,27,30) |
| InChIKey | QPPYJZOJIWHEML-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|