C33H47N3O5 — CID 18210333
tert-butyl N-[1-[butyl-[1-(3-ethenylphenyl)-2-oxo-2-(pentan-2-ylamino)ethyl]amino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]carbamate (PubChem CID 18210333) has the molecular formula C33H47N3O5 and a molecular weight of 565.76 g/mol. Its IUPAC name is tert-butyl N-[1-[butyl-[1-(3-ethenylphenyl)-2-oxo-2-(pentan-2-ylamino)ethyl]amino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[butyl-[1-(3-ethenylphenyl)-2-oxo-2-(pentan-2-ylamino)ethyl]amino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18210333 |
| Molecular Formula | C33H47N3O5 |
| Molecular Weight | 565.76 g/mol |
| Exact Mass | 565.35 |
| IUPAC Name | tert-butyl N-[1-[butyl-[1-(3-ethenylphenyl)-2-oxo-2-(pentan-2-ylamino)ethyl]amino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]carbamate |
| SMILES | C=Cc1cccc(C(C(=O)NC(C)CCC)N(CCCC)C(=O)C(Cc2ccc(O)cc2)NC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C33H47N3O5/c1-8-11-20-36(29(30(38)34-23(4)13-9-2)26-15-12-14-24(10-3)21-26)31(39)28(35-32(40)41-33(5,6)7)22-25-16-18-27(37)19-17-25/h10,12,14-19,21,23,28-29,37H,3,8-9,11,13,20,22H2,1-2,4-7H3,(H,34,38)(H,35,40) |
| InChIKey | DBFKDQAOXYOEAI-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.76 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |