C37H55N3O5 — CID 18212328
tert-butyl N-[1-[[1-(3-ethenylphenyl)-2-oxo-2-(pentan-2-ylamino)ethyl]-octylamino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]carbamate (PubChem CID 18212328) has the molecular formula C37H55N3O5 and a molecular weight of 621.86 g/mol. Its IUPAC name is tert-butyl N-[1-[[1-(3-ethenylphenyl)-2-oxo-2-(pentan-2-ylamino)ethyl]-octylamino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[1-(3-ethenylphenyl)-2-oxo-2-(pentan-2-ylamino)ethyl]-octylamino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 18212328 |
| Molecular Formula | C37H55N3O5 |
| Molecular Weight | 621.86 g/mol |
| Exact Mass | 621.41 |
| IUPAC Name | tert-butyl N-[1-[[1-(3-ethenylphenyl)-2-oxo-2-(pentan-2-ylamino)ethyl]-octylamino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]carbamate |
| SMILES | C=Cc1cccc(C(C(=O)NC(C)CCC)N(CCCCCCCC)C(=O)C(Cc2ccc(O)cc2)NC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C37H55N3O5/c1-8-11-12-13-14-15-24-40(33(34(42)38-27(4)17-9-2)30-19-16-18-28(10-3)25-30)35(43)32(39-36(44)45-37(5,6)7)26-29-20-22-31(41)23-21-29/h10,16,18-23,25,27,32-33,41H,3,8-9,11-15,17,24,26H2,1-2,4-7H3,(H,38,42)(H,39,44) |
| InChIKey | JIBABZNEAAXWCG-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.86 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|