C15H27N3O7 — CID 18222260
2-[[2-[(2-amino-4-methylpentanoyl)amino]-3-hydroxybutanoyl]amino]pentanedioic acid (PubChem CID 18222260) has the molecular formula C15H27N3O7 and a molecular weight of 361.40 g/mol. Its IUPAC name is 2-[[2-[(2-amino-4-methylpentanoyl)amino]-3-hydroxybutanoyl]amino]pentanedioic acid.
| Compound Name | 2-[[2-[(2-amino-4-methylpentanoyl)amino]-3-hydroxybutanoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 18222260 |
| Molecular Formula | C15H27N3O7 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | 2-[[2-[(2-amino-4-methylpentanoyl)amino]-3-hydroxybutanoyl]amino]pentanedioic acid |
| SMILES | CC(C)CC(N)C(=O)NC(C(=O)NC(CCC(=O)O)C(=O)O)C(C)O |
| InChI | InChI=1S/C15H27N3O7/c1-7(2)6-9(16)13(22)18-12(8(3)19)14(23)17-10(15(24)25)4-5-11(20)21/h7-10,12,19H,4-6,16H2,1-3H3,(H,17,23)(H,18,22)(H,20,21)(H,24,25) |
| InChIKey | LFSQWRSVPNKJGP-UHFFFAOYSA-N |
| XLogP | -1.34 |
| TPSA | 179.05 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |