C12H21N3O7S — CID 18222968
2-[[2-[(2-amino-4-methylsulfanylbutanoyl)amino]-3-hydroxypropanoyl]amino]butanedioic acid (PubChem CID 18222968) has the molecular formula C12H21N3O7S and a molecular weight of 351.38 g/mol. Its IUPAC name is 2-[[2-[(2-amino-4-methylsulfanylbutanoyl)amino]-3-hydroxypropanoyl]amino]butanedioic acid.
| Compound Name | 2-[[2-[(2-amino-4-methylsulfanylbutanoyl)amino]-3-hydroxypropanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 18222968 |
| Molecular Formula | C12H21N3O7S |
| Molecular Weight | 351.38 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | 2-[[2-[(2-amino-4-methylsulfanylbutanoyl)amino]-3-hydroxypropanoyl]amino]butanedioic acid |
| SMILES | CSCCC(N)C(=O)NC(CO)C(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C12H21N3O7S/c1-23-3-2-6(13)10(19)15-8(5-16)11(20)14-7(12(21)22)4-9(17)18/h6-8,16H,2-5,13H2,1H3,(H,14,20)(H,15,19)(H,17,18)(H,21,22) |
| InChIKey | RDLSEGZJMYGFNS-UHFFFAOYSA-N |
| XLogP | -2.41 |
| TPSA | 179.05 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.38 |
| LogP ≤ 5 | -2.41 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |