C19H16ClNOS — CID 18227178
N-[2-(3-chlorophenyl)ethyl]-3-phenylthiophene-2-carboxamide (PubChem CID 18227178) has the molecular formula C19H16ClNOS and a molecular weight of 341.86 g/mol. Its IUPAC name is N-[2-(3-chlorophenyl)ethyl]-3-phenylthiophene-2-carboxamide.
| Compound Name | N-[2-(3-chlorophenyl)ethyl]-3-phenylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 18227178 |
| Molecular Formula | C19H16ClNOS |
| Molecular Weight | 341.86 g/mol |
| Exact Mass | 341.06 |
| IUPAC Name | N-[2-(3-chlorophenyl)ethyl]-3-phenylthiophene-2-carboxamide |
| SMILES | O=C(NCCc1cccc(Cl)c1)c1sccc1-c1ccccc1 |
| InChI | InChI=1S/C19H16ClNOS/c20-16-8-4-5-14(13-16)9-11-21-19(22)18-17(10-12-23-18)15-6-2-1-3-7-15/h1-8,10,12-13H,9,11H2,(H,21,22) |
| InChIKey | WDIYMZQOCDGBCX-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.86 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |