C25H24FN3O — CID 18227355
1-(2-fluorophenyl)-N-[[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]methyl]ethanamine (PubChem CID 18227355) has the molecular formula C25H24FN3O and a molecular weight of 401.49 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-N-[[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]methyl]ethanamine.
| Compound Name | 1-(2-fluorophenyl)-N-[[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 18227355 |
| Molecular Formula | C25H24FN3O |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | 1-(2-fluorophenyl)-N-[[3-(4-methoxyphenyl)-1-phenylpyrazol-4-yl]methyl]ethanamine |
| SMILES | COc1ccc(-c2nn(-c3ccccc3)cc2CNC(C)c2ccccc2F)cc1 |
| InChI | InChI=1S/C25H24FN3O/c1-18(23-10-6-7-11-24(23)26)27-16-20-17-29(21-8-4-3-5-9-21)28-25(20)19-12-14-22(30-2)15-13-19/h3-15,17-18,27H,16H2,1-2H3 |
| InChIKey | SWHURCNXJSNIIJ-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |