C24H27FN6O — CID 97261642
(1S)-N-[[3-(4-butoxy-3-fluorophenyl)-1-phenylpyrazol-4-yl]methyl]-1-(1H-1,2,4-triazol-5-yl)ethanamine (PubChem CID 97261642) has the molecular formula C24H27FN6O and a molecular weight of 434.52 g/mol. Its IUPAC name is (1S)-N-[[3-(4-butoxy-3-fluorophenyl)-1-phenylpyrazol-4-yl]methyl]-1-(1H-1,2,4-triazol-5-yl)ethanamine.
| Compound Name | (1S)-N-[[3-(4-butoxy-3-fluorophenyl)-1-phenylpyrazol-4-yl]methyl]-1-(1H-1,2,4-triazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 97261642 |
| Molecular Formula | C24H27FN6O |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | (1S)-N-[[3-(4-butoxy-3-fluorophenyl)-1-phenylpyrazol-4-yl]methyl]-1-(1H-1,2,4-triazol-5-yl)ethanamine |
| SMILES | CCCCOc1ccc(-c2nn(-c3ccccc3)cc2CN[C@@H](C)c2ncn[nH]2)cc1F |
| InChI | InChI=1S/C24H27FN6O/c1-3-4-12-32-22-11-10-18(13-21(22)25)23-19(14-26-17(2)24-27-16-28-29-24)15-31(30-23)20-8-6-5-7-9-20/h5-11,13,15-17,26H,3-4,12,14H2,1-2H3,(H,27,28,29)/t17-/m0/s1 |
| InChIKey | GJBQVVPTAROJPZ-KRWDZBQOSA-N |
| XLogP | 4.83 |
| TPSA | 80.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|