C27H23FN4O3 — CID 19109427
(5E)-5-[[3-(3-fluoro-4-propoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-1,4-dimethyl-2,6-dioxopyridine-3-carbonitrile (PubChem CID 19109427) has the molecular formula C27H23FN4O3 and a molecular weight of 470.50 g/mol. Its IUPAC name is (5E)-5-[[3-(3-fluoro-4-propoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-1,4-dimethyl-2,6-dioxopyridine-3-carbonitrile.
| Compound Name | (5E)-5-[[3-(3-fluoro-4-propoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-1,4-dimethyl-2,6-dioxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19109427 |
| Molecular Formula | C27H23FN4O3 |
| Molecular Weight | 470.50 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | (5E)-5-[[3-(3-fluoro-4-propoxyphenyl)-1-phenylpyrazol-4-yl]methylidene]-1,4-dimethyl-2,6-dioxopyridine-3-carbonitrile |
| SMILES | CCCOc1ccc(-c2nn(-c3ccccc3)cc2/C=C2/C(=O)N(C)C(=O)C(C#N)=C2C)cc1F |
| InChI | InChI=1S/C27H23FN4O3/c1-4-12-35-24-11-10-18(14-23(24)28)25-19(16-32(30-25)20-8-6-5-7-9-20)13-21-17(2)22(15-29)27(34)31(3)26(21)33/h5-11,13-14,16H,4,12H2,1-3H3/b21-13+ |
| InChIKey | CMGNAMYBZVQUSG-FYJGNVAPSA-N |
| XLogP | 4.69 |
| TPSA | 88.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.50 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|