C23H31NO2 — CID 18227466
(E)-N-[1-(1-adamantyl)ethyl]-3-(2-methoxy-5-methylphenyl)prop-2-enamide (PubChem CID 18227466) has the molecular formula C23H31NO2 and a molecular weight of 353.51 g/mol. Its IUPAC name is (E)-N-[1-(1-adamantyl)ethyl]-3-(2-methoxy-5-methylphenyl)prop-2-enamide.
| Compound Name | (E)-N-[1-(1-adamantyl)ethyl]-3-(2-methoxy-5-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 18227466 |
| Molecular Formula | C23H31NO2 |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.24 |
| IUPAC Name | (E)-N-[1-(1-adamantyl)ethyl]-3-(2-methoxy-5-methylphenyl)prop-2-enamide |
| SMILES | COc1ccc(C)cc1/C=C/C(=O)NC(C)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C23H31NO2/c1-15-4-6-21(26-3)20(8-15)5-7-22(25)24-16(2)23-12-17-9-18(13-23)11-19(10-17)14-23/h4-8,16-19H,9-14H2,1-3H3,(H,24,25)/b7-5+ |
| InChIKey | VEYAJMDHPLCVBK-FNORWQNLSA-N |
| XLogP | 4.74 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|