C21H25Cl2NO — CID 3301196
N-[1-(1-adamantyl)ethyl]-3-(3,4-dichlorophenyl)prop-2-enamide (PubChem CID 3301196) has the molecular formula C21H25Cl2NO and a molecular weight of 378.34 g/mol. Its IUPAC name is N-[1-(1-adamantyl)ethyl]-3-(3,4-dichlorophenyl)prop-2-enamide.
| Compound Name | N-[1-(1-adamantyl)ethyl]-3-(3,4-dichlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 3301196 |
| Molecular Formula | C21H25Cl2NO |
| Molecular Weight | 378.34 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | N-[1-(1-adamantyl)ethyl]-3-(3,4-dichlorophenyl)prop-2-enamide |
| SMILES | CC(NC(=O)C=Cc1ccc(Cl)c(Cl)c1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C21H25Cl2NO/c1-13(21-10-15-6-16(11-21)8-17(7-15)12-21)24-20(25)5-3-14-2-4-18(22)19(23)9-14/h2-5,9,13,15-17H,6-8,10-12H2,1H3,(H,24,25) |
| InChIKey | WKMUHVVUPNKQRJ-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.34 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|