About (6-bromonaphthalen-2-yl) 3-(2,2-dimethylpropanoylamino)propanoate
(6-bromonaphthalen-2-yl) 3-(2,2-dimethylpropanoylamino)propanoate (PubChem CID 18227507) has the molecular formula C18H20BrNO3
and a molecular weight of 378.27 g/mol. Its IUPAC name is (6-bromonaphthalen-2-yl) 3-(2,2-dimethylpropanoylamino)propanoate.
Molecular Properties
| Compound Name | (6-bromonaphthalen-2-yl) 3-(2,2-dimethylpropanoylamino)propanoate |
| PubChem CID | 18227507 |
| Molecular Formula | C18H20BrNO3 |
| Molecular Weight | 378.27 g/mol |
| Exact Mass | 377.06 |
| IUPAC Name | (6-bromonaphthalen-2-yl) 3-(2,2-dimethylpropanoylamino)propanoate |
| SMILES | CC(C)(C)C(=O)NCCC(=O)Oc1ccc2cc(Br)ccc2c1 |
| InChI | InChI=1S/C18H20BrNO3/c1-18(2,3)17(22)20-9-8-16(21)23-15-7-5-12-10-14(19)6-4-13(12)11-15/h4-7,10-11H,8-9H2,1-3H3,(H,20,22) |
| InChIKey | HGRLTRWQCVITCZ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.27 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (6-bromonaphthalen-2-yl) 3-(2,2-dimethylpropanoylamino)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-bromonaphthalen-2-yl) 3-(2,2-dimethylpropanoylamino)propanoate?
The IUPAC name of (6-bromonaphthalen-2-yl) 3-(2,2-dimethylpropanoylamino)propanoate (CID 18227507) is (6-bromonaphthalen-2-yl) 3-(2,2-dimethylpropanoylamino)propanoate.
What is the SMILES notation for (6-bromonaphthalen-2-yl) 3-(2,2-dimethylpropanoylamino)propanoate?
The canonical SMILES for (6-bromonaphthalen-2-yl) 3-(2,2-dimethylpropanoylamino)propanoate is CC(C)(C)C(=O)NCCC(=O)Oc1ccc2cc(Br)ccc2c1.
What is the InChIKey of (6-bromonaphthalen-2-yl) 3-(2,2-dimethylpropanoylamino)propanoate?
The InChIKey is HGRLTRWQCVITCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20BrNO3/c1-18(2,3)17(22)20-9-8-16(21)23-15-7-5-12-10-14(19)6-4-13(12)11-15/h4-7,10-11H,8-9H2,1-3H3,(H,20,22).
What are the key properties of (6-bromonaphthalen-2-yl) 3-(2,2-dimethylpropanoylamino)propanoate?
(6-bromonaphthalen-2-yl) 3-(2,2-dimethylpropanoylamino)propanoate has a molecular weight of 378.27 g/mol, XLogP of 4.06, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6-bromonaphthalen-2-yl) 3-(2,2-dimethylpropanoylamino)propanoate is sourced from PubChem (CID 18227507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).