About (6-bromonaphthalen-2-yl) N-propan-2-ylcarbamate
(6-bromonaphthalen-2-yl) N-propan-2-ylcarbamate (PubChem CID 3678098) has the molecular formula C14H14BrNO2
and a molecular weight of 308.18 g/mol. Its IUPAC name is (6-bromonaphthalen-2-yl) N-propan-2-ylcarbamate.
Molecular Properties
| Compound Name | (6-bromonaphthalen-2-yl) N-propan-2-ylcarbamate |
| PubChem CID | 3678098 |
| Molecular Formula | C14H14BrNO2 |
| Molecular Weight | 308.18 g/mol |
| Exact Mass | 307.02 |
| IUPAC Name | (6-bromonaphthalen-2-yl) N-propan-2-ylcarbamate |
| SMILES | CC(C)NC(=O)Oc1ccc2cc(Br)ccc2c1 |
| InChI | InChI=1S/C14H14BrNO2/c1-9(2)16-14(17)18-13-6-4-10-7-12(15)5-3-11(10)8-13/h3-9H,1-2H3,(H,16,17) |
| InChIKey | JQZGYOLTKIJQJR-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.18 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (6-bromonaphthalen-2-yl) N-propan-2-ylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-bromonaphthalen-2-yl) N-propan-2-ylcarbamate?
The IUPAC name of (6-bromonaphthalen-2-yl) N-propan-2-ylcarbamate (CID 3678098) is (6-bromonaphthalen-2-yl) N-propan-2-ylcarbamate.
What is the SMILES notation for (6-bromonaphthalen-2-yl) N-propan-2-ylcarbamate?
The canonical SMILES for (6-bromonaphthalen-2-yl) N-propan-2-ylcarbamate is CC(C)NC(=O)Oc1ccc2cc(Br)ccc2c1.
What is the InChIKey of (6-bromonaphthalen-2-yl) N-propan-2-ylcarbamate?
The InChIKey is JQZGYOLTKIJQJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14BrNO2/c1-9(2)16-14(17)18-13-6-4-10-7-12(15)5-3-11(10)8-13/h3-9H,1-2H3,(H,16,17).
What are the key properties of (6-bromonaphthalen-2-yl) N-propan-2-ylcarbamate?
(6-bromonaphthalen-2-yl) N-propan-2-ylcarbamate has a molecular weight of 308.18 g/mol, XLogP of 4.10, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6-bromonaphthalen-2-yl) N-propan-2-ylcarbamate is sourced from PubChem (CID 3678098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).