About dimethyl-[2-(2-oxo-3,4-dihydroquinolin-1-yl)ethyl]azanium chloride
dimethyl-[2-(2-oxo-3,4-dihydroquinolin-1-yl)ethyl]azanium chloride (PubChem CID 18228) has the molecular formula C13H19ClN2O
and a molecular weight of 254.76 g/mol. Its IUPAC name is dimethyl-[2-(2-oxo-3,4-dihydroquinolin-1-yl)ethyl]azanium chloride.
Molecular Properties
| Compound Name | dimethyl-[2-(2-oxo-3,4-dihydroquinolin-1-yl)ethyl]azanium chloride |
| PubChem CID | 18228 |
| Molecular Formula | C13H19ClN2O |
| Molecular Weight | 254.76 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | dimethyl-[2-(2-oxo-3,4-dihydroquinolin-1-yl)ethyl]azanium chloride |
| SMILES | C[NH+](C)CCN1C(=O)CCc2ccccc21.[Cl-] |
| InChI | InChI=1S/C13H18N2O.ClH/c1-14(2)9-10-15-12-6-4-3-5-11(12)7-8-13(15)16;/h3-6H,7-10H2,1-2H3;1H |
| InChIKey | LXCOMOVWFAXNTC-UHFFFAOYSA-N |
| XLogP | -2.89 |
| TPSA | 24.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.76 |
| LogP ≤ 5 | -2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze dimethyl-[2-(2-oxo-3,4-dihydroquinolin-1-yl)ethyl]azanium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl-[2-(2-oxo-3,4-dihydroquinolin-1-yl)ethyl]azanium chloride?
The IUPAC name of dimethyl-[2-(2-oxo-3,4-dihydroquinolin-1-yl)ethyl]azanium chloride (CID 18228) is dimethyl-[2-(2-oxo-3,4-dihydroquinolin-1-yl)ethyl]azanium chloride.
What is the SMILES notation for dimethyl-[2-(2-oxo-3,4-dihydroquinolin-1-yl)ethyl]azanium chloride?
The canonical SMILES for dimethyl-[2-(2-oxo-3,4-dihydroquinolin-1-yl)ethyl]azanium chloride is C[NH+](C)CCN1C(=O)CCc2ccccc21.[Cl-].
What is the InChIKey of dimethyl-[2-(2-oxo-3,4-dihydroquinolin-1-yl)ethyl]azanium chloride?
The InChIKey is LXCOMOVWFAXNTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2O.ClH/c1-14(2)9-10-15-12-6-4-3-5-11(12)7-8-13(15)16;/h3-6H,7-10H2,1-2H3;1H.
What are the key properties of dimethyl-[2-(2-oxo-3,4-dihydroquinolin-1-yl)ethyl]azanium chloride?
dimethyl-[2-(2-oxo-3,4-dihydroquinolin-1-yl)ethyl]azanium chloride has a molecular weight of 254.76 g/mol, XLogP of -2.89, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl-[2-(2-oxo-3,4-dihydroquinolin-1-yl)ethyl]azanium chloride is sourced from PubChem (CID 18228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).