C21H25N3O2S — CID 18228324
N-(5-tert-butyl-2-hydroxyphenyl)-2-ethyl-4,5-dimethylthieno[2,3-d]pyrimidine-6-carboxamide (PubChem CID 18228324) has the molecular formula C21H25N3O2S and a molecular weight of 383.52 g/mol. Its IUPAC name is N-(5-tert-butyl-2-hydroxyphenyl)-2-ethyl-4,5-dimethylthieno[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | N-(5-tert-butyl-2-hydroxyphenyl)-2-ethyl-4,5-dimethylthieno[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 18228324 |
| Molecular Formula | C21H25N3O2S |
| Molecular Weight | 383.52 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | N-(5-tert-butyl-2-hydroxyphenyl)-2-ethyl-4,5-dimethylthieno[2,3-d]pyrimidine-6-carboxamide |
| SMILES | CCc1nc(C)c2c(C)c(C(=O)Nc3cc(C(C)(C)C)ccc3O)sc2n1 |
| InChI | InChI=1S/C21H25N3O2S/c1-7-16-22-12(3)17-11(2)18(27-20(17)24-16)19(26)23-14-10-13(21(4,5)6)8-9-15(14)25/h8-10,25H,7H2,1-6H3,(H,23,26) |
| InChIKey | CYPGXRZWYNTHLS-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.52 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|