C28H25NO4 — CID 18229343
[1-(4-methoxyphenyl)-1-oxopropan-2-yl] 2-(2-methyl-4-phenylquinolin-3-yl)acetate (PubChem CID 18229343) has the molecular formula C28H25NO4 and a molecular weight of 439.51 g/mol. Its IUPAC name is [1-(4-methoxyphenyl)-1-oxopropan-2-yl] 2-(2-methyl-4-phenylquinolin-3-yl)acetate.
| Compound Name | [1-(4-methoxyphenyl)-1-oxopropan-2-yl] 2-(2-methyl-4-phenylquinolin-3-yl)acetate |
|---|---|
| PubChem CID | 18229343 |
| Molecular Formula | C28H25NO4 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | [1-(4-methoxyphenyl)-1-oxopropan-2-yl] 2-(2-methyl-4-phenylquinolin-3-yl)acetate |
| SMILES | COc1ccc(C(=O)C(C)OC(=O)Cc2c(C)nc3ccccc3c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C28H25NO4/c1-18-24(17-26(30)33-19(2)28(31)21-13-15-22(32-3)16-14-21)27(20-9-5-4-6-10-20)23-11-7-8-12-25(23)29-18/h4-16,19H,17H2,1-3H3 |
| InChIKey | BWKRLJFSPVLKLZ-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |