C17H27N7O6S — CID 18235055
2-[[2-[[5-amino-2-(2-aminopropanoylamino)-5-oxopentanoyl]amino]-3-sulfanylpropanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid (PubChem CID 18235055) has the molecular formula C17H27N7O6S and a molecular weight of 457.51 g/mol. Its IUPAC name is 2-[[2-[[5-amino-2-(2-aminopropanoylamino)-5-oxopentanoyl]amino]-3-sulfanylpropanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid.
| Compound Name | 2-[[2-[[5-amino-2-(2-aminopropanoylamino)-5-oxopentanoyl]amino]-3-sulfanylpropanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid |
|---|---|
| PubChem CID | 18235055 |
| Molecular Formula | C17H27N7O6S |
| Molecular Weight | 457.51 g/mol |
| Exact Mass | 457.17 |
| IUPAC Name | 2-[[2-[[5-amino-2-(2-aminopropanoylamino)-5-oxopentanoyl]amino]-3-sulfanylpropanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid |
| SMILES | CC(N)C(=O)NC(CCC(N)=O)C(=O)NC(CS)C(=O)NC(Cc1cnc[nH]1)C(=O)O |
| InChI | InChI=1S/C17H27N7O6S/c1-8(18)14(26)22-10(2-3-13(19)25)15(27)24-12(6-31)16(28)23-11(17(29)30)4-9-5-20-7-21-9/h5,7-8,10-12,31H,2-4,6,18H2,1H3,(H2,19,25)(H,20,21)(H,22,26)(H,23,28)(H,24,27)(H,29,30) |
| InChIKey | RHIHFFOXALNEDO-UHFFFAOYSA-N |
| XLogP | -2.97 |
| TPSA | 222.39 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.51 |
| LogP ≤ 5 | -2.97 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|