C18H29N7O7S — CID 18747656
2-[[2-[[5-amino-2-[(2-amino-3-hydroxybutanoyl)amino]-5-oxopentanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-sulfanylpropanoic acid (PubChem CID 18747656) has the molecular formula C18H29N7O7S and a molecular weight of 487.54 g/mol. Its IUPAC name is 2-[[2-[[5-amino-2-[(2-amino-3-hydroxybutanoyl)amino]-5-oxopentanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-sulfanylpropanoic acid.
| Compound Name | 2-[[2-[[5-amino-2-[(2-amino-3-hydroxybutanoyl)amino]-5-oxopentanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 18747656 |
| Molecular Formula | C18H29N7O7S |
| Molecular Weight | 487.54 g/mol |
| Exact Mass | 487.18 |
| IUPAC Name | 2-[[2-[[5-amino-2-[(2-amino-3-hydroxybutanoyl)amino]-5-oxopentanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-sulfanylpropanoic acid |
| SMILES | CC(O)C(N)C(=O)NC(CCC(N)=O)C(=O)NC(Cc1cnc[nH]1)C(=O)NC(CS)C(=O)O |
| InChI | InChI=1S/C18H29N7O7S/c1-8(26)14(20)17(30)23-10(2-3-13(19)27)15(28)24-11(4-9-5-21-7-22-9)16(29)25-12(6-33)18(31)32/h5,7-8,10-12,14,26,33H,2-4,6,20H2,1H3,(H2,19,27)(H,21,22)(H,23,30)(H,24,28)(H,25,29)(H,31,32) |
| InChIKey | CXWSYHWSDNJDBF-UHFFFAOYSA-N |
| XLogP | -3.61 |
| TPSA | 242.62 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.54 |
| LogP ≤ 5 | -3.61 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|