C20H30N6O10 — CID 18747201
4-[[2-[(2-amino-3-hydroxybutanoyl)amino]-4-carboxybutanoyl]amino]-5-[[1-carboxy-2-(1H-imidazol-5-yl)ethyl]amino]-5-oxopentanoic acid (PubChem CID 18747201) has the molecular formula C20H30N6O10 and a molecular weight of 514.49 g/mol. Its IUPAC name is 4-[[2-[(2-amino-3-hydroxybutanoyl)amino]-4-carboxybutanoyl]amino]-5-[[1-carboxy-2-(1H-imidazol-5-yl)ethyl]amino]-5-oxopentanoic acid.
| Compound Name | 4-[[2-[(2-amino-3-hydroxybutanoyl)amino]-4-carboxybutanoyl]amino]-5-[[1-carboxy-2-(1H-imidazol-5-yl)ethyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 18747201 |
| Molecular Formula | C20H30N6O10 |
| Molecular Weight | 514.49 g/mol |
| Exact Mass | 514.20 |
| IUPAC Name | 4-[[2-[(2-amino-3-hydroxybutanoyl)amino]-4-carboxybutanoyl]amino]-5-[[1-carboxy-2-(1H-imidazol-5-yl)ethyl]amino]-5-oxopentanoic acid |
| SMILES | CC(O)C(N)C(=O)NC(CCC(=O)O)C(=O)NC(CCC(=O)O)C(=O)NC(Cc1cnc[nH]1)C(=O)O |
| InChI | InChI=1S/C20H30N6O10/c1-9(27)16(21)19(34)25-12(3-5-15(30)31)17(32)24-11(2-4-14(28)29)18(33)26-13(20(35)36)6-10-7-22-8-23-10/h7-9,11-13,16,27H,2-6,21H2,1H3,(H,22,23)(H,24,32)(H,25,34)(H,26,33)(H,28,29)(H,30,31)(H,35,36) |
| InChIKey | KAIJODMKGLPMRD-UHFFFAOYSA-N |
| XLogP | -3.07 |
| TPSA | 274.13 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.49 |
| LogP ≤ 5 | -3.07 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |