C20H31N7O9 — CID 18747258
5-amino-2-[[2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-4-carboxybutanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-5-oxopentanoic acid (PubChem CID 18747258) has the molecular formula C20H31N7O9 and a molecular weight of 513.51 g/mol. Its IUPAC name is 5-amino-2-[[2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-4-carboxybutanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-5-oxopentanoic acid.
| Compound Name | 5-amino-2-[[2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-4-carboxybutanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 18747258 |
| Molecular Formula | C20H31N7O9 |
| Molecular Weight | 513.51 g/mol |
| Exact Mass | 513.22 |
| IUPAC Name | 5-amino-2-[[2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-4-carboxybutanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-5-oxopentanoic acid |
| SMILES | CC(O)C(N)C(=O)NC(CCC(=O)O)C(=O)NC(Cc1cnc[nH]1)C(=O)NC(CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C20H31N7O9/c1-9(28)16(22)19(34)25-11(3-5-15(30)31)17(32)27-13(6-10-7-23-8-24-10)18(33)26-12(20(35)36)2-4-14(21)29/h7-9,11-13,16,28H,2-6,22H2,1H3,(H2,21,29)(H,23,24)(H,25,34)(H,26,33)(H,27,32)(H,30,31)(H,35,36) |
| InChIKey | WQOMZEUJZZQMMO-UHFFFAOYSA-N |
| XLogP | -3.67 |
| TPSA | 279.92 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.51 |
| LogP ≤ 5 | -3.67 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |