C17H27N7O7S — CID 18746059
2-[[2-[[4-amino-2-[(2-amino-3-hydroxybutanoyl)amino]-4-oxobutanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-sulfanylpropanoic acid (PubChem CID 18746059) has the molecular formula C17H27N7O7S and a molecular weight of 473.51 g/mol. Its IUPAC name is 2-[[2-[[4-amino-2-[(2-amino-3-hydroxybutanoyl)amino]-4-oxobutanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-sulfanylpropanoic acid.
| Compound Name | 2-[[2-[[4-amino-2-[(2-amino-3-hydroxybutanoyl)amino]-4-oxobutanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 18746059 |
| Molecular Formula | C17H27N7O7S |
| Molecular Weight | 473.51 g/mol |
| Exact Mass | 473.17 |
| IUPAC Name | 2-[[2-[[4-amino-2-[(2-amino-3-hydroxybutanoyl)amino]-4-oxobutanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-sulfanylpropanoic acid |
| SMILES | CC(O)C(N)C(=O)NC(CC(N)=O)C(=O)NC(Cc1cnc[nH]1)C(=O)NC(CS)C(=O)O |
| InChI | InChI=1S/C17H27N7O7S/c1-7(25)13(19)16(29)23-10(3-12(18)26)15(28)22-9(2-8-4-20-6-21-8)14(27)24-11(5-32)17(30)31/h4,6-7,9-11,13,25,32H,2-3,5,19H2,1H3,(H2,18,26)(H,20,21)(H,22,28)(H,23,29)(H,24,27)(H,30,31) |
| InChIKey | FGEINGAHJPXLBA-UHFFFAOYSA-N |
| XLogP | -4.00 |
| TPSA | 242.62 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.51 |
| LogP ≤ 5 | -4.00 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|