C18H26N6O10 — CID 18748355
2-[[2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-carboxypropanoyl]amino]butanedioic acid (PubChem CID 18748355) has the molecular formula C18H26N6O10 and a molecular weight of 486.44 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-carboxypropanoyl]amino]butanedioic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-carboxypropanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 18748355 |
| Molecular Formula | C18H26N6O10 |
| Molecular Weight | 486.44 g/mol |
| Exact Mass | 486.17 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-3-hydroxybutanoyl)amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-carboxypropanoyl]amino]butanedioic acid |
| SMILES | CC(O)C(N)C(=O)NC(Cc1cnc[nH]1)C(=O)NC(CC(=O)O)C(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C18H26N6O10/c1-7(25)14(19)17(32)23-9(2-8-5-20-6-21-8)15(30)22-10(3-12(26)27)16(31)24-11(18(33)34)4-13(28)29/h5-7,9-11,14,25H,2-4,19H2,1H3,(H,20,21)(H,22,30)(H,23,32)(H,24,31)(H,26,27)(H,28,29)(H,33,34) |
| InChIKey | IOJMHZCPOWWUHM-UHFFFAOYSA-N |
| XLogP | -3.85 |
| TPSA | 274.13 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.44 |
| LogP ≤ 5 | -3.85 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |