C19H25N5O5S — CID 18235462
2-[[2-[[2-(2-aminopropanoylamino)acetyl]amino]-3-sulfanylpropanoyl]amino]-3-(1H-indol-3-yl)propanoic acid (PubChem CID 18235462) has the molecular formula C19H25N5O5S and a molecular weight of 435.51 g/mol. Its IUPAC name is 2-[[2-[[2-(2-aminopropanoylamino)acetyl]amino]-3-sulfanylpropanoyl]amino]-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | 2-[[2-[[2-(2-aminopropanoylamino)acetyl]amino]-3-sulfanylpropanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 18235462 |
| Molecular Formula | C19H25N5O5S |
| Molecular Weight | 435.51 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | 2-[[2-[[2-(2-aminopropanoylamino)acetyl]amino]-3-sulfanylpropanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
| SMILES | CC(N)C(=O)NCC(=O)NC(CS)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C19H25N5O5S/c1-10(20)17(26)22-8-16(25)23-15(9-30)18(27)24-14(19(28)29)6-11-7-21-13-5-3-2-4-12(11)13/h2-5,7,10,14-15,21,30H,6,8-9,20H2,1H3,(H,22,26)(H,23,25)(H,24,27)(H,28,29) |
| InChIKey | KESOTQHTSBKFSK-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 166.41 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.51 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|