C21H28N6O6S — CID 18234231
2-[[4-amino-2-[[2-(2-aminopropanoylamino)-3-sulfanylpropanoyl]amino]-4-oxobutanoyl]amino]-3-(1H-indol-3-yl)propanoic acid (PubChem CID 18234231) has the molecular formula C21H28N6O6S and a molecular weight of 492.56 g/mol. Its IUPAC name is 2-[[4-amino-2-[[2-(2-aminopropanoylamino)-3-sulfanylpropanoyl]amino]-4-oxobutanoyl]amino]-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | 2-[[4-amino-2-[[2-(2-aminopropanoylamino)-3-sulfanylpropanoyl]amino]-4-oxobutanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 18234231 |
| Molecular Formula | C21H28N6O6S |
| Molecular Weight | 492.56 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | 2-[[4-amino-2-[[2-(2-aminopropanoylamino)-3-sulfanylpropanoyl]amino]-4-oxobutanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
| SMILES | CC(N)C(=O)NC(CS)C(=O)NC(CC(N)=O)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C21H28N6O6S/c1-10(22)18(29)27-16(9-34)20(31)25-14(7-17(23)28)19(30)26-15(21(32)33)6-11-8-24-13-5-3-2-4-12(11)13/h2-5,8,10,14-16,24,34H,6-7,9,22H2,1H3,(H2,23,28)(H,25,31)(H,26,30)(H,27,29)(H,32,33) |
| InChIKey | PJSYMOOEYUNUQX-UHFFFAOYSA-N |
| XLogP | -1.60 |
| TPSA | 209.50 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.56 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|