C23H29N7O5S — CID 18236099
2-[[2-[[2-(2-aminopropanoylamino)-3-(1H-imidazol-5-yl)propanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-sulfanylpropanoic acid (PubChem CID 18236099) has the molecular formula C23H29N7O5S and a molecular weight of 515.60 g/mol. Its IUPAC name is 2-[[2-[[2-(2-aminopropanoylamino)-3-(1H-imidazol-5-yl)propanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-sulfanylpropanoic acid.
| Compound Name | 2-[[2-[[2-(2-aminopropanoylamino)-3-(1H-imidazol-5-yl)propanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 18236099 |
| Molecular Formula | C23H29N7O5S |
| Molecular Weight | 515.60 g/mol |
| Exact Mass | 515.20 |
| IUPAC Name | 2-[[2-[[2-(2-aminopropanoylamino)-3-(1H-imidazol-5-yl)propanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-sulfanylpropanoic acid |
| SMILES | CC(N)C(=O)NC(Cc1cnc[nH]1)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NC(CS)C(=O)O |
| InChI | InChI=1S/C23H29N7O5S/c1-12(24)20(31)28-18(7-14-9-25-11-27-14)22(33)29-17(21(32)30-19(10-36)23(34)35)6-13-8-26-16-5-3-2-4-15(13)16/h2-5,8-9,11-12,17-19,26,36H,6-7,10,24H2,1H3,(H,25,27)(H,28,31)(H,29,33)(H,30,32)(H,34,35) |
| InChIKey | GUOHRJMBUCMUEM-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 195.09 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.60 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|