C24H31N7O6S — CID 19945565
2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-hydroxybutanoyl]amino]-3-sulfanylpropanoic acid (PubChem CID 19945565) has the molecular formula C24H31N7O6S and a molecular weight of 545.62 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-hydroxybutanoyl]amino]-3-sulfanylpropanoic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-hydroxybutanoyl]amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 19945565 |
| Molecular Formula | C24H31N7O6S |
| Molecular Weight | 545.62 g/mol |
| Exact Mass | 545.21 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-hydroxybutanoyl]amino]-3-sulfanylpropanoic acid |
| SMILES | CC(O)C(NC(=O)C(Cc1cnc[nH]1)NC(=O)C(N)Cc1c[nH]c2ccccc12)C(=O)NC(CS)C(=O)O |
| InChI | InChI=1S/C24H31N7O6S/c1-12(32)20(23(35)30-19(10-38)24(36)37)31-22(34)18(7-14-9-26-11-28-14)29-21(33)16(25)6-13-8-27-17-5-3-2-4-15(13)17/h2-5,8-9,11-12,16,18-20,27,32,38H,6-7,10,25H2,1H3,(H,26,28)(H,29,33)(H,30,35)(H,31,34)(H,36,37) |
| InChIKey | DUBRKUMEKZYZSO-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 215.32 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.62 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|