C24H35N5O6S — CID 19946359
2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-methylpentanoyl]amino]-3-hydroxybutanoyl]amino]-3-sulfanylpropanoic acid (PubChem CID 19946359) has the molecular formula C24H35N5O6S and a molecular weight of 521.64 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-methylpentanoyl]amino]-3-hydroxybutanoyl]amino]-3-sulfanylpropanoic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-methylpentanoyl]amino]-3-hydroxybutanoyl]amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 19946359 |
| Molecular Formula | C24H35N5O6S |
| Molecular Weight | 521.64 g/mol |
| Exact Mass | 521.23 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-methylpentanoyl]amino]-3-hydroxybutanoyl]amino]-3-sulfanylpropanoic acid |
| SMILES | CC(C)CC(NC(=O)C(N)Cc1c[nH]c2ccccc12)C(=O)NC(C(=O)NC(CS)C(=O)O)C(C)O |
| InChI | InChI=1S/C24H35N5O6S/c1-12(2)8-18(22(32)29-20(13(3)30)23(33)28-19(11-36)24(34)35)27-21(31)16(25)9-14-10-26-17-7-5-4-6-15(14)17/h4-7,10,12-13,16,18-20,26,30,36H,8-9,11,25H2,1-3H3,(H,27,31)(H,28,33)(H,29,32)(H,34,35) |
| InChIKey | CAMMIGKLSAOROV-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 186.64 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.64 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|