C21H29N5O7S — CID 18743597
2-[[2-[[2-[(2-amino-3-hydroxypropanoyl)amino]-3-hydroxybutanoyl]amino]-3-sulfanylpropanoyl]amino]-3-(1H-indol-3-yl)propanoic acid (PubChem CID 18743597) has the molecular formula C21H29N5O7S and a molecular weight of 495.56 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-3-hydroxypropanoyl)amino]-3-hydroxybutanoyl]amino]-3-sulfanylpropanoyl]amino]-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-3-hydroxypropanoyl)amino]-3-hydroxybutanoyl]amino]-3-sulfanylpropanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 18743597 |
| Molecular Formula | C21H29N5O7S |
| Molecular Weight | 495.56 g/mol |
| Exact Mass | 495.18 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-3-hydroxypropanoyl)amino]-3-hydroxybutanoyl]amino]-3-sulfanylpropanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
| SMILES | CC(O)C(NC(=O)C(N)CO)C(=O)NC(CS)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C21H29N5O7S/c1-10(28)17(26-18(29)13(22)8-27)20(31)25-16(9-34)19(30)24-15(21(32)33)6-11-7-23-14-5-3-2-4-12(11)14/h2-5,7,10,13,15-17,23,27-28,34H,6,8-9,22H2,1H3,(H,24,30)(H,25,31)(H,26,29)(H,32,33) |
| InChIKey | RPKYPEYRJBSFAB-UHFFFAOYSA-N |
| XLogP | -2.12 |
| TPSA | 206.87 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.56 |
| LogP ≤ 5 | -2.12 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|