C22H30N6O7S — CID 19943170
2-[[2-[[4-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-oxobutanoyl]amino]-3-hydroxybutanoyl]amino]-3-sulfanylpropanoic acid (PubChem CID 19943170) has the molecular formula C22H30N6O7S and a molecular weight of 522.58 g/mol. Its IUPAC name is 2-[[2-[[4-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-oxobutanoyl]amino]-3-hydroxybutanoyl]amino]-3-sulfanylpropanoic acid.
| Compound Name | 2-[[2-[[4-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-oxobutanoyl]amino]-3-hydroxybutanoyl]amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 19943170 |
| Molecular Formula | C22H30N6O7S |
| Molecular Weight | 522.58 g/mol |
| Exact Mass | 522.19 |
| IUPAC Name | 2-[[2-[[4-amino-2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-oxobutanoyl]amino]-3-hydroxybutanoyl]amino]-3-sulfanylpropanoic acid |
| SMILES | CC(O)C(NC(=O)C(CC(N)=O)NC(=O)C(N)Cc1c[nH]c2ccccc12)C(=O)NC(CS)C(=O)O |
| InChI | InChI=1S/C22H30N6O7S/c1-10(29)18(21(33)27-16(9-36)22(34)35)28-20(32)15(7-17(24)30)26-19(31)13(23)6-11-8-25-14-5-3-2-4-12(11)14/h2-5,8,10,13,15-16,18,25,29,36H,6-7,9,23H2,1H3,(H2,24,30)(H,26,31)(H,27,33)(H,28,32)(H,34,35) |
| InChIKey | HBMYDFJGZSHXHY-UHFFFAOYSA-N |
| XLogP | -2.24 |
| TPSA | 229.73 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.58 |
| LogP ≤ 5 | -2.24 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|