C17H30N4O7S — CID 18236239
2-[[2-[[2-(2-aminopropanoylamino)-3-methylpentanoyl]amino]-3-sulfanylpropanoyl]amino]pentanedioic acid (PubChem CID 18236239) has the molecular formula C17H30N4O7S and a molecular weight of 434.52 g/mol. Its IUPAC name is 2-[[2-[[2-(2-aminopropanoylamino)-3-methylpentanoyl]amino]-3-sulfanylpropanoyl]amino]pentanedioic acid.
| Compound Name | 2-[[2-[[2-(2-aminopropanoylamino)-3-methylpentanoyl]amino]-3-sulfanylpropanoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 18236239 |
| Molecular Formula | C17H30N4O7S |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | 2-[[2-[[2-(2-aminopropanoylamino)-3-methylpentanoyl]amino]-3-sulfanylpropanoyl]amino]pentanedioic acid |
| SMILES | CCC(C)C(NC(=O)C(C)N)C(=O)NC(CS)C(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C17H30N4O7S/c1-4-8(2)13(21-14(24)9(3)18)16(26)20-11(7-29)15(25)19-10(17(27)28)5-6-12(22)23/h8-11,13,29H,4-7,18H2,1-3H3,(H,19,25)(H,20,26)(H,21,24)(H,22,23)(H,27,28) |
| InChIKey | ITGRRBHWZHZYEG-UHFFFAOYSA-N |
| XLogP | -1.29 |
| TPSA | 187.92 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|