C19H36N8O6 — CID 18241489
2-[[2-[[4-amino-2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-oxobutanoyl]amino]-3-methylpentanoyl]amino]propanoic acid (PubChem CID 18241489) has the molecular formula C19H36N8O6 and a molecular weight of 472.55 g/mol. Its IUPAC name is 2-[[2-[[4-amino-2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-oxobutanoyl]amino]-3-methylpentanoyl]amino]propanoic acid.
| Compound Name | 2-[[2-[[4-amino-2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-oxobutanoyl]amino]-3-methylpentanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 18241489 |
| Molecular Formula | C19H36N8O6 |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.28 |
| IUPAC Name | 2-[[2-[[4-amino-2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-oxobutanoyl]amino]-3-methylpentanoyl]amino]propanoic acid |
| SMILES | CCC(C)C(NC(=O)C(CC(N)=O)NC(=O)C(N)CCCN=C(N)N)C(=O)NC(C)C(=O)O |
| InChI | InChI=1S/C19H36N8O6/c1-4-9(2)14(17(31)25-10(3)18(32)33)27-16(30)12(8-13(21)28)26-15(29)11(20)6-5-7-24-19(22)23/h9-12,14H,4-8,20H2,1-3H3,(H2,21,28)(H,25,31)(H,26,29)(H,27,30)(H,32,33)(H4,22,23,24) |
| InChIKey | XQJSYZXNSPBFQZ-UHFFFAOYSA-N |
| XLogP | -3.15 |
| TPSA | 258.11 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | -3.15 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|