C22H39N7O7 — CID 18244776
2-[[1-[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylpentanoyl]pyrrolidine-2-carbonyl]amino]pentanedioic acid (PubChem CID 18244776) has the molecular formula C22H39N7O7 and a molecular weight of 513.60 g/mol. Its IUPAC name is 2-[[1-[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylpentanoyl]pyrrolidine-2-carbonyl]amino]pentanedioic acid.
| Compound Name | 2-[[1-[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylpentanoyl]pyrrolidine-2-carbonyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 18244776 |
| Molecular Formula | C22H39N7O7 |
| Molecular Weight | 513.60 g/mol |
| Exact Mass | 513.29 |
| IUPAC Name | 2-[[1-[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylpentanoyl]pyrrolidine-2-carbonyl]amino]pentanedioic acid |
| SMILES | CC(C)CC(NC(=O)C(N)CCCN=C(N)N)C(=O)N1CCCC1C(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C22H39N7O7/c1-12(2)11-15(28-18(32)13(23)5-3-9-26-22(24)25)20(34)29-10-4-6-16(29)19(33)27-14(21(35)36)7-8-17(30)31/h12-16H,3-11,23H2,1-2H3,(H,27,33)(H,28,32)(H,30,31)(H,35,36)(H4,24,25,26) |
| InChIKey | OLXGCSFKFIQNAJ-UHFFFAOYSA-N |
| XLogP | -1.68 |
| TPSA | 243.53 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.60 |
| LogP ≤ 5 | -1.68 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|