C19H33N7O8 — CID 22650375
2-[[1-[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxypropanoyl]pyrrolidine-2-carbonyl]amino]pentanedioic acid (PubChem CID 22650375) has the molecular formula C19H33N7O8 and a molecular weight of 487.51 g/mol. Its IUPAC name is 2-[[1-[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxypropanoyl]pyrrolidine-2-carbonyl]amino]pentanedioic acid.
| Compound Name | 2-[[1-[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxypropanoyl]pyrrolidine-2-carbonyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 22650375 |
| Molecular Formula | C19H33N7O8 |
| Molecular Weight | 487.51 g/mol |
| Exact Mass | 487.24 |
| IUPAC Name | 2-[[1-[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxypropanoyl]pyrrolidine-2-carbonyl]amino]pentanedioic acid |
| SMILES | NC(N)=NCCCC(N)C(=O)NC(CO)C(=O)N1CCCC1C(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C19H33N7O8/c20-10(3-1-7-23-19(21)22)15(30)25-12(9-27)17(32)26-8-2-4-13(26)16(31)24-11(18(33)34)5-6-14(28)29/h10-13,27H,1-9,20H2,(H,24,31)(H,25,30)(H,28,29)(H,33,34)(H4,21,22,23) |
| InChIKey | KIJXHUYBCGWHKI-UHFFFAOYSA-N |
| XLogP | -3.73 |
| TPSA | 263.76 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.51 |
| LogP ≤ 5 | -3.73 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|