C25H29N7O9 — CID 18253452
2-[[2-[[2-[(2-amino-3-carboxypropanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]butanedioic acid (PubChem CID 18253452) has the molecular formula C25H29N7O9 and a molecular weight of 571.55 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-3-carboxypropanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]butanedioic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-3-carboxypropanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 18253452 |
| Molecular Formula | C25H29N7O9 |
| Molecular Weight | 571.55 g/mol |
| Exact Mass | 571.20 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-3-carboxypropanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]butanedioic acid |
| SMILES | NC(CC(=O)O)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NC(Cc1cnc[nH]1)C(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C25H29N7O9/c26-15(7-20(33)34)22(37)30-17(5-12-9-28-16-4-2-1-3-14(12)16)23(38)31-18(6-13-10-27-11-29-13)24(39)32-19(25(40)41)8-21(35)36/h1-4,9-11,15,17-19,28H,5-8,26H2,(H,27,29)(H,30,37)(H,31,38)(H,32,39)(H,33,34)(H,35,36)(H,40,41) |
| InChIKey | JUFZHUHHSLKTIM-UHFFFAOYSA-N |
| XLogP | -1.51 |
| TPSA | 269.69 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.55 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |