C25H30N8O8 — CID 19945284
2-[[4-amino-2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-4-oxobutanoyl]amino]butanedioic acid (PubChem CID 19945284) has the molecular formula C25H30N8O8 and a molecular weight of 570.56 g/mol. Its IUPAC name is 2-[[4-amino-2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-4-oxobutanoyl]amino]butanedioic acid.
| Compound Name | 2-[[4-amino-2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-4-oxobutanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 19945284 |
| Molecular Formula | C25H30N8O8 |
| Molecular Weight | 570.56 g/mol |
| Exact Mass | 570.22 |
| IUPAC Name | 2-[[4-amino-2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-4-oxobutanoyl]amino]butanedioic acid |
| SMILES | NC(=O)CC(NC(=O)C(Cc1cnc[nH]1)NC(=O)C(N)Cc1c[nH]c2ccccc12)C(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C25H30N8O8/c26-15(5-12-9-29-16-4-2-1-3-14(12)16)22(37)31-17(6-13-10-28-11-30-13)23(38)32-18(7-20(27)34)24(39)33-19(25(40)41)8-21(35)36/h1-4,9-11,15,17-19,29H,5-8,26H2,(H2,27,34)(H,28,30)(H,31,37)(H,32,38)(H,33,39)(H,35,36)(H,40,41) |
| InChIKey | CCLRODMSTGHUKZ-UHFFFAOYSA-N |
| XLogP | -2.11 |
| TPSA | 275.48 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.56 |
| LogP ≤ 5 | -2.11 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |