C25H34N6O8 — CID 18253471
3-amino-4-[[1-[[1-[(3-amino-1-carboxy-3-oxopropyl)amino]-3-methyl-1-oxopentan-2-yl]amino]-3-(1H-indol-3-yl)-1-oxopropan-2-yl]amino]-4-oxobutanoic acid (PubChem CID 18253471) has the molecular formula C25H34N6O8 and a molecular weight of 546.58 g/mol. Its IUPAC name is 3-amino-4-[[1-[[1-[(3-amino-1-carboxy-3-oxopropyl)amino]-3-methyl-1-oxopentan-2-yl]amino]-3-(1H-indol-3-yl)-1-oxopropan-2-yl]amino]-4-oxobutanoic acid.
| Compound Name | 3-amino-4-[[1-[[1-[(3-amino-1-carboxy-3-oxopropyl)amino]-3-methyl-1-oxopentan-2-yl]amino]-3-(1H-indol-3-yl)-1-oxopropan-2-yl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 18253471 |
| Molecular Formula | C25H34N6O8 |
| Molecular Weight | 546.58 g/mol |
| Exact Mass | 546.24 |
| IUPAC Name | 3-amino-4-[[1-[[1-[(3-amino-1-carboxy-3-oxopropyl)amino]-3-methyl-1-oxopentan-2-yl]amino]-3-(1H-indol-3-yl)-1-oxopropan-2-yl]amino]-4-oxobutanoic acid |
| SMILES | CCC(C)C(NC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)C(N)CC(=O)O)C(=O)NC(CC(N)=O)C(=O)O |
| InChI | InChI=1S/C25H34N6O8/c1-3-12(2)21(24(37)30-18(25(38)39)10-19(27)32)31-23(36)17(29-22(35)15(26)9-20(33)34)8-13-11-28-16-7-5-4-6-14(13)16/h4-7,11-12,15,17-18,21,28H,3,8-10,26H2,1-2H3,(H2,27,32)(H,29,35)(H,30,37)(H,31,36)(H,33,34)(H,38,39) |
| InChIKey | SBDINMGRPNCRDC-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 246.80 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.58 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |