C27H39N5O7 — CID 22706362
2-[[2-[[2-[(2-amino-4-methylpentanoyl)amino]-3-methylpentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]butanedioic acid (PubChem CID 22706362) has the molecular formula C27H39N5O7 and a molecular weight of 545.64 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-4-methylpentanoyl)amino]-3-methylpentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]butanedioic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-4-methylpentanoyl)amino]-3-methylpentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 22706362 |
| Molecular Formula | C27H39N5O7 |
| Molecular Weight | 545.64 g/mol |
| Exact Mass | 545.28 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-4-methylpentanoyl)amino]-3-methylpentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]butanedioic acid |
| SMILES | CCC(C)C(NC(=O)C(N)CC(C)C)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C27H39N5O7/c1-5-15(4)23(32-24(35)18(28)10-14(2)3)26(37)30-20(25(36)31-21(27(38)39)12-22(33)34)11-16-13-29-19-9-7-6-8-17(16)19/h6-9,13-15,18,20-21,23,29H,5,10-12,28H2,1-4H3,(H,30,37)(H,31,36)(H,32,35)(H,33,34)(H,38,39) |
| InChIKey | FUZDPLJSNXCQEW-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 203.71 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.64 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |