C24H35N5O10 — CID 18253911
2-[[6-amino-2-[[2-[(2-amino-3-carboxypropanoyl)amino]-3-(4-hydroxyphenyl)propanoyl]amino]hexanoyl]amino]pentanedioic acid (PubChem CID 18253911) has the molecular formula C24H35N5O10 and a molecular weight of 553.57 g/mol. Its IUPAC name is 2-[[6-amino-2-[[2-[(2-amino-3-carboxypropanoyl)amino]-3-(4-hydroxyphenyl)propanoyl]amino]hexanoyl]amino]pentanedioic acid.
| Compound Name | 2-[[6-amino-2-[[2-[(2-amino-3-carboxypropanoyl)amino]-3-(4-hydroxyphenyl)propanoyl]amino]hexanoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 18253911 |
| Molecular Formula | C24H35N5O10 |
| Molecular Weight | 553.57 g/mol |
| Exact Mass | 553.24 |
| IUPAC Name | 2-[[6-amino-2-[[2-[(2-amino-3-carboxypropanoyl)amino]-3-(4-hydroxyphenyl)propanoyl]amino]hexanoyl]amino]pentanedioic acid |
| SMILES | NCCCCC(NC(=O)C(Cc1ccc(O)cc1)NC(=O)C(N)CC(=O)O)C(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C24H35N5O10/c25-10-2-1-3-16(22(36)28-17(24(38)39)8-9-19(31)32)27-23(37)18(11-13-4-6-14(30)7-5-13)29-21(35)15(26)12-20(33)34/h4-7,15-18,30H,1-3,8-12,25-26H2,(H,27,37)(H,28,36)(H,29,35)(H,31,32)(H,33,34)(H,38,39) |
| InChIKey | ABGDREJCVFDYMH-UHFFFAOYSA-N |
| XLogP | -1.73 |
| TPSA | 271.47 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.57 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|