C19H31N7O6S — CID 18257724
2-[[4-amino-2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-4-oxobutanoyl]amino]-3-methylpentanoic acid (PubChem CID 18257724) has the molecular formula C19H31N7O6S and a molecular weight of 485.57 g/mol. Its IUPAC name is 2-[[4-amino-2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-4-oxobutanoyl]amino]-3-methylpentanoic acid.
| Compound Name | 2-[[4-amino-2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-4-oxobutanoyl]amino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 18257724 |
| Molecular Formula | C19H31N7O6S |
| Molecular Weight | 485.57 g/mol |
| Exact Mass | 485.21 |
| IUPAC Name | 2-[[4-amino-2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-4-oxobutanoyl]amino]-3-methylpentanoic acid |
| SMILES | CCC(C)C(NC(=O)C(CC(N)=O)NC(=O)C(Cc1cnc[nH]1)NC(=O)C(N)CS)C(=O)O |
| InChI | InChI=1S/C19H31N7O6S/c1-3-9(2)15(19(31)32)26-18(30)13(5-14(21)27)25-17(29)12(4-10-6-22-8-23-10)24-16(28)11(20)7-33/h6,8-9,11-13,15,33H,3-5,7,20H2,1-2H3,(H2,21,27)(H,22,23)(H,24,28)(H,25,29)(H,26,30)(H,31,32) |
| InChIKey | SHKKNKYYXLZZIJ-UHFFFAOYSA-N |
| XLogP | -2.33 |
| TPSA | 222.39 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.57 |
| LogP ≤ 5 | -2.33 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|