C20H32N6O7S — CID 18257784
2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-4-carboxybutanoyl]amino]-3-methylpentanoic acid (PubChem CID 18257784) has the molecular formula C20H32N6O7S and a molecular weight of 500.58 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-4-carboxybutanoyl]amino]-3-methylpentanoic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-4-carboxybutanoyl]amino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 18257784 |
| Molecular Formula | C20H32N6O7S |
| Molecular Weight | 500.58 g/mol |
| Exact Mass | 500.21 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-4-carboxybutanoyl]amino]-3-methylpentanoic acid |
| SMILES | CCC(C)C(NC(=O)C(CCC(=O)O)NC(=O)C(Cc1cnc[nH]1)NC(=O)C(N)CS)C(=O)O |
| InChI | InChI=1S/C20H32N6O7S/c1-3-10(2)16(20(32)33)26-18(30)13(4-5-15(27)28)24-19(31)14(6-11-7-22-9-23-11)25-17(29)12(21)8-34/h7,9-10,12-14,16,34H,3-6,8,21H2,1-2H3,(H,22,23)(H,24,31)(H,25,29)(H,26,30)(H,27,28)(H,32,33) |
| InChIKey | BKUPFHZDPYGHHQ-UHFFFAOYSA-N |
| XLogP | -1.34 |
| TPSA | 216.60 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.58 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|