C23H39N7O7 — CID 18304463
2-[[2-[[4-carboxy-2-(2,6-diaminohexanoylamino)butanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-methylpentanoic acid (PubChem CID 18304463) has the molecular formula C23H39N7O7 and a molecular weight of 525.61 g/mol. Its IUPAC name is 2-[[2-[[4-carboxy-2-(2,6-diaminohexanoylamino)butanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-methylpentanoic acid.
| Compound Name | 2-[[2-[[4-carboxy-2-(2,6-diaminohexanoylamino)butanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 18304463 |
| Molecular Formula | C23H39N7O7 |
| Molecular Weight | 525.61 g/mol |
| Exact Mass | 525.29 |
| IUPAC Name | 2-[[2-[[4-carboxy-2-(2,6-diaminohexanoylamino)butanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-3-methylpentanoic acid |
| SMILES | CCC(C)C(NC(=O)C(Cc1cnc[nH]1)NC(=O)C(CCC(=O)O)NC(=O)C(N)CCCCN)C(=O)O |
| InChI | InChI=1S/C23H39N7O7/c1-3-13(2)19(23(36)37)30-22(35)17(10-14-11-26-12-27-14)29-21(34)16(7-8-18(31)32)28-20(33)15(25)6-4-5-9-24/h11-13,15-17,19H,3-10,24-25H2,1-2H3,(H,26,27)(H,28,33)(H,29,34)(H,30,35)(H,31,32)(H,36,37) |
| InChIKey | QSQQDWBQWDDHQH-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 242.62 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.61 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|