C14H24N4O5S — CID 18260072
2-[2-[[1-(2-amino-3-sulfanylpropanoyl)pyrrolidine-2-carbonyl]amino]propanoylamino]propanoic acid (PubChem CID 18260072) has the molecular formula C14H24N4O5S and a molecular weight of 360.44 g/mol. Its IUPAC name is 2-[2-[[1-(2-amino-3-sulfanylpropanoyl)pyrrolidine-2-carbonyl]amino]propanoylamino]propanoic acid.
| Compound Name | 2-[2-[[1-(2-amino-3-sulfanylpropanoyl)pyrrolidine-2-carbonyl]amino]propanoylamino]propanoic acid |
|---|---|
| PubChem CID | 18260072 |
| Molecular Formula | C14H24N4O5S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | 2-[2-[[1-(2-amino-3-sulfanylpropanoyl)pyrrolidine-2-carbonyl]amino]propanoylamino]propanoic acid |
| SMILES | CC(NC(=O)C(C)NC(=O)C1CCCN1C(=O)C(N)CS)C(=O)O |
| InChI | InChI=1S/C14H24N4O5S/c1-7(11(19)17-8(2)14(22)23)16-12(20)10-4-3-5-18(10)13(21)9(15)6-24/h7-10,24H,3-6,15H2,1-2H3,(H,16,20)(H,17,19)(H,22,23) |
| InChIKey | IMDQVKJRMQJYPM-UHFFFAOYSA-N |
| XLogP | -1.67 |
| TPSA | 141.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|