C21H27N5O7 — CID 18262801
4-amino-5-[[1-[[1-(carboxymethylamino)-3-(1H-indol-3-yl)-1-oxopropan-2-yl]amino]-1-oxopropan-2-yl]amino]-5-oxopentanoic acid (PubChem CID 18262801) has the molecular formula C21H27N5O7 and a molecular weight of 461.48 g/mol. Its IUPAC name is 4-amino-5-[[1-[[1-(carboxymethylamino)-3-(1H-indol-3-yl)-1-oxopropan-2-yl]amino]-1-oxopropan-2-yl]amino]-5-oxopentanoic acid.
| Compound Name | 4-amino-5-[[1-[[1-(carboxymethylamino)-3-(1H-indol-3-yl)-1-oxopropan-2-yl]amino]-1-oxopropan-2-yl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 18262801 |
| Molecular Formula | C21H27N5O7 |
| Molecular Weight | 461.48 g/mol |
| Exact Mass | 461.19 |
| IUPAC Name | 4-amino-5-[[1-[[1-(carboxymethylamino)-3-(1H-indol-3-yl)-1-oxopropan-2-yl]amino]-1-oxopropan-2-yl]amino]-5-oxopentanoic acid |
| SMILES | CC(NC(=O)C(N)CCC(=O)O)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NCC(=O)O |
| InChI | InChI=1S/C21H27N5O7/c1-11(25-20(32)14(22)6-7-17(27)28)19(31)26-16(21(33)24-10-18(29)30)8-12-9-23-15-5-3-2-4-13(12)15/h2-5,9,11,14,16,23H,6-8,10,22H2,1H3,(H,24,33)(H,25,32)(H,26,31)(H,27,28)(H,29,30) |
| InChIKey | IFLALUOHAHECKI-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 203.71 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.48 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |