C24H33N5O7 — CID 19944251
4-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-5-[[1-(carboxymethylamino)-4-methyl-1-oxopentan-2-yl]amino]-5-oxopentanoic acid (PubChem CID 19944251) has the molecular formula C24H33N5O7 and a molecular weight of 503.56 g/mol. Its IUPAC name is 4-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-5-[[1-(carboxymethylamino)-4-methyl-1-oxopentan-2-yl]amino]-5-oxopentanoic acid.
| Compound Name | 4-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-5-[[1-(carboxymethylamino)-4-methyl-1-oxopentan-2-yl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 19944251 |
| Molecular Formula | C24H33N5O7 |
| Molecular Weight | 503.56 g/mol |
| Exact Mass | 503.24 |
| IUPAC Name | 4-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-5-[[1-(carboxymethylamino)-4-methyl-1-oxopentan-2-yl]amino]-5-oxopentanoic acid |
| SMILES | CC(C)CC(NC(=O)C(CCC(=O)O)NC(=O)C(N)Cc1c[nH]c2ccccc12)C(=O)NCC(=O)O |
| InChI | InChI=1S/C24H33N5O7/c1-13(2)9-19(23(35)27-12-21(32)33)29-24(36)18(7-8-20(30)31)28-22(34)16(25)10-14-11-26-17-6-4-3-5-15(14)17/h3-6,11,13,16,18-19,26H,7-10,12,25H2,1-2H3,(H,27,35)(H,28,34)(H,29,36)(H,30,31)(H,32,33) |
| InChIKey | QOHNQYYFQZTRBS-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 203.71 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.56 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |