C30H47N7O6 — CID 22609187
2-[[6-amino-2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-methylpentanoyl]amino]-3-methylbutanoyl]amino]hexanoyl]amino]acetic acid (PubChem CID 22609187) has the molecular formula C30H47N7O6 and a molecular weight of 601.75 g/mol. Its IUPAC name is 2-[[6-amino-2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-methylpentanoyl]amino]-3-methylbutanoyl]amino]hexanoyl]amino]acetic acid.
| Compound Name | 2-[[6-amino-2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-methylpentanoyl]amino]-3-methylbutanoyl]amino]hexanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 22609187 |
| Molecular Formula | C30H47N7O6 |
| Molecular Weight | 601.75 g/mol |
| Exact Mass | 601.36 |
| IUPAC Name | 2-[[6-amino-2-[[2-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-methylpentanoyl]amino]-3-methylbutanoyl]amino]hexanoyl]amino]acetic acid |
| SMILES | CC(C)CC(NC(=O)C(N)Cc1c[nH]c2ccccc12)C(=O)NC(C(=O)NC(CCCCN)C(=O)NCC(=O)O)C(C)C |
| InChI | InChI=1S/C30H47N7O6/c1-17(2)13-24(36-27(40)21(32)14-19-15-33-22-10-6-5-9-20(19)22)29(42)37-26(18(3)4)30(43)35-23(11-7-8-12-31)28(41)34-16-25(38)39/h5-6,9-10,15,17-18,21,23-24,26,33H,7-8,11-14,16,31-32H2,1-4H3,(H,34,41)(H,35,43)(H,36,40)(H,37,42)(H,38,39) |
| InChIKey | CQXQIMKTLKLGSC-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 221.53 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.75 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|