C22H33N5O8 — CID 18265600
6-amino-2-[[2-[[2-[(2-amino-4-carboxybutanoyl)amino]acetyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]hexanoic acid (PubChem CID 18265600) has the molecular formula C22H33N5O8 and a molecular weight of 495.53 g/mol. Its IUPAC name is 6-amino-2-[[2-[[2-[(2-amino-4-carboxybutanoyl)amino]acetyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[[2-[(2-amino-4-carboxybutanoyl)amino]acetyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 18265600 |
| Molecular Formula | C22H33N5O8 |
| Molecular Weight | 495.53 g/mol |
| Exact Mass | 495.23 |
| IUPAC Name | 6-amino-2-[[2-[[2-[(2-amino-4-carboxybutanoyl)amino]acetyl]amino]-3-(4-hydroxyphenyl)propanoyl]amino]hexanoic acid |
| SMILES | NCCCCC(NC(=O)C(Cc1ccc(O)cc1)NC(=O)CNC(=O)C(N)CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C22H33N5O8/c23-10-2-1-3-16(22(34)35)27-21(33)17(11-13-4-6-14(28)7-5-13)26-18(29)12-25-20(32)15(24)8-9-19(30)31/h4-7,15-17,28H,1-3,8-12,23-24H2,(H,25,32)(H,26,29)(H,27,33)(H,30,31)(H,34,35) |
| InChIKey | AQXBHHALNBQTRT-UHFFFAOYSA-N |
| XLogP | -1.57 |
| TPSA | 234.17 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.53 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|